C8H13N5O — CID 130521809
[2,3-dihydrofuran-5-yl-(1-methyltriazol-4-yl)methyl]hydrazine (PubChem CID 130521809) has the molecular formula C8H13N5O and a molecular weight of 195.23 g/mol. Its IUPAC name is [2,3-dihydrofuran-5-yl-(1-methyltriazol-4-yl)methyl]hydrazine.
| Compound Name | [2,3-dihydrofuran-5-yl-(1-methyltriazol-4-yl)methyl]hydrazine |
|---|---|
| PubChem CID | 130521809 |
| Molecular Formula | C8H13N5O |
| Molecular Weight | 195.23 g/mol |
| Exact Mass | 195.11 |
| IUPAC Name | [2,3-dihydrofuran-5-yl-(1-methyltriazol-4-yl)methyl]hydrazine |
| SMILES | Cn1cc(C(NN)C2=CCCO2)nn1 |
| InChI | InChI=1S/C8H13N5O/c1-13-5-6(11-12-13)8(10-9)7-3-2-4-14-7/h3,5,8,10H,2,4,9H2,1H3 |
| InChIKey | DJLOHKJLACEYND-UHFFFAOYSA-N |
| XLogP | -0.38 |
| TPSA | 77.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.23 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|