C14H20N2O4 — CID 102654431
[2,3-dihydrofuran-5-yl-(3,4,5-trimethoxyphenyl)methyl]hydrazine (PubChem CID 102654431) has the molecular formula C14H20N2O4 and a molecular weight of 280.32 g/mol. Its IUPAC name is [2,3-dihydrofuran-5-yl-(3,4,5-trimethoxyphenyl)methyl]hydrazine.
| Compound Name | [2,3-dihydrofuran-5-yl-(3,4,5-trimethoxyphenyl)methyl]hydrazine |
|---|---|
| PubChem CID | 102654431 |
| Molecular Formula | C14H20N2O4 |
| Molecular Weight | 280.32 g/mol |
| Exact Mass | 280.14 |
| IUPAC Name | [2,3-dihydrofuran-5-yl-(3,4,5-trimethoxyphenyl)methyl]hydrazine |
| SMILES | COc1cc(C(NN)C2=CCCO2)cc(OC)c1OC |
| InChI | InChI=1S/C14H20N2O4/c1-17-11-7-9(8-12(18-2)14(11)19-3)13(16-15)10-5-4-6-20-10/h5,7-8,13,16H,4,6,15H2,1-3H3 |
| InChIKey | MSDYAXVCWLTONK-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 74.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.32 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|