C17H25NO3 — CID 62079581
1-(cyclohexen-1-yl)-N-methyl-1-(3,4,5-trimethoxyphenyl)methanamine (PubChem CID 62079581) has the molecular formula C17H25NO3 and a molecular weight of 291.39 g/mol. Its IUPAC name is 1-(cyclohexen-1-yl)-N-methyl-1-(3,4,5-trimethoxyphenyl)methanamine.
| Compound Name | 1-(cyclohexen-1-yl)-N-methyl-1-(3,4,5-trimethoxyphenyl)methanamine |
|---|---|
| PubChem CID | 62079581 |
| Molecular Formula | C17H25NO3 |
| Molecular Weight | 291.39 g/mol |
| Exact Mass | 291.18 |
| IUPAC Name | 1-(cyclohexen-1-yl)-N-methyl-1-(3,4,5-trimethoxyphenyl)methanamine |
| SMILES | CNC(C1=CCCCC1)c1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C17H25NO3/c1-18-16(12-8-6-5-7-9-12)13-10-14(19-2)17(21-4)15(11-13)20-3/h8,10-11,16,18H,5-7,9H2,1-4H3 |
| InChIKey | KMTCJNBRNLPPRJ-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.39 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|