C14H16F3N — CID 55160436
1-(cyclohexen-1-yl)-N-methyl-1-(3,4,5-trifluorophenyl)methanamine (PubChem CID 55160436) has the molecular formula C14H16F3N and a molecular weight of 255.28 g/mol. Its IUPAC name is 1-(cyclohexen-1-yl)-N-methyl-1-(3,4,5-trifluorophenyl)methanamine.
| Compound Name | 1-(cyclohexen-1-yl)-N-methyl-1-(3,4,5-trifluorophenyl)methanamine |
|---|---|
| PubChem CID | 55160436 |
| Molecular Formula | C14H16F3N |
| Molecular Weight | 255.28 g/mol |
| Exact Mass | 255.12 |
| IUPAC Name | 1-(cyclohexen-1-yl)-N-methyl-1-(3,4,5-trifluorophenyl)methanamine |
| SMILES | CNC(C1=CCCCC1)c1cc(F)c(F)c(F)c1 |
| InChI | InChI=1S/C14H16F3N/c1-18-14(9-5-3-2-4-6-9)10-7-11(15)13(17)12(16)8-10/h5,7-8,14,18H,2-4,6H2,1H3 |
| InChIKey | PPOBAZQZRPLFOA-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.28 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|