C15H19ClFN — CID 107995961
1-(4-chloro-3-fluorophenyl)-1-(cyclohepten-1-yl)-N-methylmethanamine (PubChem CID 107995961) has the molecular formula C15H19ClFN and a molecular weight of 267.78 g/mol. Its IUPAC name is 1-(4-chloro-3-fluorophenyl)-1-(cyclohepten-1-yl)-N-methylmethanamine.
| Compound Name | 1-(4-chloro-3-fluorophenyl)-1-(cyclohepten-1-yl)-N-methylmethanamine |
|---|---|
| PubChem CID | 107995961 |
| Molecular Formula | C15H19ClFN |
| Molecular Weight | 267.78 g/mol |
| Exact Mass | 267.12 |
| IUPAC Name | 1-(4-chloro-3-fluorophenyl)-1-(cyclohepten-1-yl)-N-methylmethanamine |
| SMILES | CNC(C1=CCCCCC1)c1ccc(Cl)c(F)c1 |
| InChI | InChI=1S/C15H19ClFN/c1-18-15(11-6-4-2-3-5-7-11)12-8-9-13(16)14(17)10-12/h6,8-10,15,18H,2-5,7H2,1H3 |
| InChIKey | YICBBWJYGNSSLO-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.78 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|