C16H21ClFN — CID 106652930
1-(3-chloro-4-fluorophenyl)-1-[(1E)-cycloocten-1-yl]-N-methylmethanamine (PubChem CID 106652930) has the molecular formula C16H21ClFN and a molecular weight of 281.80 g/mol. Its IUPAC name is 1-(3-chloro-4-fluorophenyl)-1-[(1E)-cycloocten-1-yl]-N-methylmethanamine.
| Compound Name | 1-(3-chloro-4-fluorophenyl)-1-[(1E)-cycloocten-1-yl]-N-methylmethanamine |
|---|---|
| PubChem CID | 106652930 |
| Molecular Formula | C16H21ClFN |
| Molecular Weight | 281.80 g/mol |
| Exact Mass | 281.13 |
| IUPAC Name | 1-(3-chloro-4-fluorophenyl)-1-[(1E)-cycloocten-1-yl]-N-methylmethanamine |
| SMILES | CNC(/C1=C/CCCCCC1)c1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C16H21ClFN/c1-19-16(12-7-5-3-2-4-6-8-12)13-9-10-15(18)14(17)11-13/h7,9-11,16,19H,2-6,8H2,1H3/b12-7+ |
| InChIKey | WRDBESJLJVNGCW-KPKJPENVSA-N |
| XLogP | 5.02 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.80 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|