C15H19F2NO — CID 62080331
1-(cyclohexen-1-yl)-1-[4-(difluoromethoxy)phenyl]-N-methylmethanamine (PubChem CID 62080331) has the molecular formula C15H19F2NO and a molecular weight of 267.32 g/mol. Its IUPAC name is 1-(cyclohexen-1-yl)-1-[4-(difluoromethoxy)phenyl]-N-methylmethanamine.
| Compound Name | 1-(cyclohexen-1-yl)-1-[4-(difluoromethoxy)phenyl]-N-methylmethanamine |
|---|---|
| PubChem CID | 62080331 |
| Molecular Formula | C15H19F2NO |
| Molecular Weight | 267.32 g/mol |
| Exact Mass | 267.14 |
| IUPAC Name | 1-(cyclohexen-1-yl)-1-[4-(difluoromethoxy)phenyl]-N-methylmethanamine |
| SMILES | CNC(C1=CCCCC1)c1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C15H19F2NO/c1-18-14(11-5-3-2-4-6-11)12-7-9-13(10-8-12)19-15(16)17/h5,7-10,14-15,18H,2-4,6H2,1H3 |
| InChIKey | MXSDSNFIWIOMAQ-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.32 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|