C14H17BrFN — CID 62079579
1-(5-bromo-2-fluorophenyl)-1-(cyclohexen-1-yl)-N-methylmethanamine (PubChem CID 62079579) has the molecular formula C14H17BrFN and a molecular weight of 298.20 g/mol. Its IUPAC name is 1-(5-bromo-2-fluorophenyl)-1-(cyclohexen-1-yl)-N-methylmethanamine.
| Compound Name | 1-(5-bromo-2-fluorophenyl)-1-(cyclohexen-1-yl)-N-methylmethanamine |
|---|---|
| PubChem CID | 62079579 |
| Molecular Formula | C14H17BrFN |
| Molecular Weight | 298.20 g/mol |
| Exact Mass | 297.05 |
| IUPAC Name | 1-(5-bromo-2-fluorophenyl)-1-(cyclohexen-1-yl)-N-methylmethanamine |
| SMILES | CNC(C1=CCCCC1)c1cc(Br)ccc1F |
| InChI | InChI=1S/C14H17BrFN/c1-17-14(10-5-3-2-4-6-10)12-9-11(15)7-8-13(12)16/h5,7-9,14,17H,2-4,6H2,1H3 |
| InChIKey | ICPOSDYSNMUILY-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.20 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|