C15H20ClN — CID 106859015
1-(2-chloro-4-methylphenyl)-1-(cyclohexen-1-yl)-N-methylmethanamine (PubChem CID 106859015) has the molecular formula C15H20ClN and a molecular weight of 249.78 g/mol. Its IUPAC name is 1-(2-chloro-4-methylphenyl)-1-(cyclohexen-1-yl)-N-methylmethanamine.
| Compound Name | 1-(2-chloro-4-methylphenyl)-1-(cyclohexen-1-yl)-N-methylmethanamine |
|---|---|
| PubChem CID | 106859015 |
| Molecular Formula | C15H20ClN |
| Molecular Weight | 249.78 g/mol |
| Exact Mass | 249.13 |
| IUPAC Name | 1-(2-chloro-4-methylphenyl)-1-(cyclohexen-1-yl)-N-methylmethanamine |
| SMILES | CNC(C1=CCCCC1)c1ccc(C)cc1Cl |
| InChI | InChI=1S/C15H20ClN/c1-11-8-9-13(14(16)10-11)15(17-2)12-6-4-3-5-7-12/h6,8-10,15,17H,3-5,7H2,1-2H3 |
| InChIKey | NMXTUWWUBNPAKJ-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.78 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|