C16H23ClN2 — CID 106650026
[(4-chloro-3-methylphenyl)-[(1E)-cycloocten-1-yl]methyl]hydrazine (PubChem CID 106650026) has the molecular formula C16H23ClN2 and a molecular weight of 278.83 g/mol. Its IUPAC name is [(4-chloro-3-methylphenyl)-[(1E)-cycloocten-1-yl]methyl]hydrazine.
| Compound Name | [(4-chloro-3-methylphenyl)-[(1E)-cycloocten-1-yl]methyl]hydrazine |
|---|---|
| PubChem CID | 106650026 |
| Molecular Formula | C16H23ClN2 |
| Molecular Weight | 278.83 g/mol |
| Exact Mass | 278.15 |
| IUPAC Name | [(4-chloro-3-methylphenyl)-[(1E)-cycloocten-1-yl]methyl]hydrazine |
| SMILES | Cc1cc(C(NN)/C2=C/CCCCCC2)ccc1Cl |
| InChI | InChI=1S/C16H23ClN2/c1-12-11-14(9-10-15(12)17)16(19-18)13-7-5-3-2-4-6-8-13/h7,9-11,16,19H,2-6,8,18H2,1H3/b13-7+ |
| InChIKey | OQLWMXVIHDDCRB-NTUHNPAUSA-N |
| XLogP | 4.43 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.83 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|