C14H20N2 — CID 106756069
1-(cyclohexen-1-yl)-N-methyl-1-(2-methyl-4-pyridinyl)methanamine (PubChem CID 106756069) has the molecular formula C14H20N2 and a molecular weight of 216.33 g/mol. Its IUPAC name is 1-(cyclohexen-1-yl)-N-methyl-1-(2-methyl-4-pyridinyl)methanamine.
| Compound Name | 1-(cyclohexen-1-yl)-N-methyl-1-(2-methyl-4-pyridinyl)methanamine |
|---|---|
| PubChem CID | 106756069 |
| Molecular Formula | C14H20N2 |
| Molecular Weight | 216.33 g/mol |
| Exact Mass | 216.16 |
| IUPAC Name | 1-(cyclohexen-1-yl)-N-methyl-1-(2-methyl-4-pyridinyl)methanamine |
| SMILES | CNC(C1=CCCCC1)c1ccnc(C)c1 |
| InChI | InChI=1S/C14H20N2/c1-11-10-13(8-9-16-11)14(15-2)12-6-4-3-5-7-12/h6,8-10,14-15H,3-5,7H2,1-2H3 |
| InChIKey | XIAIUSRGIUHGSA-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.33 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|