C15H17F3O — CID 106651057
[(1E)-cycloocten-1-yl]-(3,4,5-trifluorophenyl)methanol (PubChem CID 106651057) has the molecular formula C15H17F3O and a molecular weight of 270.29 g/mol. Its IUPAC name is [(1E)-cycloocten-1-yl]-(3,4,5-trifluorophenyl)methanol.
| Compound Name | [(1E)-cycloocten-1-yl]-(3,4,5-trifluorophenyl)methanol |
|---|---|
| PubChem CID | 106651057 |
| Molecular Formula | C15H17F3O |
| Molecular Weight | 270.29 g/mol |
| Exact Mass | 270.12 |
| IUPAC Name | [(1E)-cycloocten-1-yl]-(3,4,5-trifluorophenyl)methanol |
| SMILES | OC(/C1=C/CCCCCC1)c1cc(F)c(F)c(F)c1 |
| InChI | InChI=1S/C15H17F3O/c16-12-8-11(9-13(17)14(12)18)15(19)10-6-4-2-1-3-5-7-10/h6,8-9,15,19H,1-5,7H2/b10-6+ |
| InChIKey | RIANKGUZGIICNE-UXBLZVDNSA-N |
| XLogP | 4.42 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.29 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|