C15H18F2O — CID 106651011
[(1E)-cycloocten-1-yl]-(2,6-difluorophenyl)methanol (PubChem CID 106651011) has the molecular formula C15H18F2O and a molecular weight of 252.30 g/mol. Its IUPAC name is [(1E)-cycloocten-1-yl]-(2,6-difluorophenyl)methanol.
| Compound Name | [(1E)-cycloocten-1-yl]-(2,6-difluorophenyl)methanol |
|---|---|
| PubChem CID | 106651011 |
| Molecular Formula | C15H18F2O |
| Molecular Weight | 252.30 g/mol |
| Exact Mass | 252.13 |
| IUPAC Name | [(1E)-cycloocten-1-yl]-(2,6-difluorophenyl)methanol |
| SMILES | OC(/C1=C/CCCCCC1)c1c(F)cccc1F |
| InChI | InChI=1S/C15H18F2O/c16-12-9-6-10-13(17)14(12)15(18)11-7-4-2-1-3-5-8-11/h6-7,9-10,15,18H,1-5,8H2/b11-7+ |
| InChIKey | WBKAUJZTSOWBJG-YRNVUSSQSA-N |
| XLogP | 4.28 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.30 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|