C16H20F2O — CID 106657648
1-[(1E)-cycloocten-1-yl]-2-(2,3-difluorophenyl)ethanol (PubChem CID 106657648) has the molecular formula C16H20F2O and a molecular weight of 266.33 g/mol. Its IUPAC name is 1-[(1E)-cycloocten-1-yl]-2-(2,3-difluorophenyl)ethanol.
| Compound Name | 1-[(1E)-cycloocten-1-yl]-2-(2,3-difluorophenyl)ethanol |
|---|---|
| PubChem CID | 106657648 |
| Molecular Formula | C16H20F2O |
| Molecular Weight | 266.33 g/mol |
| Exact Mass | 266.15 |
| IUPAC Name | 1-[(1E)-cycloocten-1-yl]-2-(2,3-difluorophenyl)ethanol |
| SMILES | OC(Cc1cccc(F)c1F)/C1=C/CCCCCC1 |
| InChI | InChI=1S/C16H20F2O/c17-14-10-6-9-13(16(14)18)11-15(19)12-7-4-2-1-3-5-8-12/h6-7,9-10,15,19H,1-5,8,11H2/b12-7+ |
| InChIKey | GFSXFAFWCDZJMW-KPKJPENVSA-N |
| XLogP | 4.15 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.33 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|