C16H21FO — CID 106657529
[(1E)-cycloocten-1-yl]-(2-fluoro-3-methylphenyl)methanol (PubChem CID 106657529) has the molecular formula C16H21FO and a molecular weight of 248.34 g/mol. Its IUPAC name is [(1E)-cycloocten-1-yl]-(2-fluoro-3-methylphenyl)methanol.
| Compound Name | [(1E)-cycloocten-1-yl]-(2-fluoro-3-methylphenyl)methanol |
|---|---|
| PubChem CID | 106657529 |
| Molecular Formula | C16H21FO |
| Molecular Weight | 248.34 g/mol |
| Exact Mass | 248.16 |
| IUPAC Name | [(1E)-cycloocten-1-yl]-(2-fluoro-3-methylphenyl)methanol |
| SMILES | Cc1cccc(C(O)/C2=C/CCCCCC2)c1F |
| InChI | InChI=1S/C16H21FO/c1-12-8-7-11-14(15(12)17)16(18)13-9-5-3-2-4-6-10-13/h7-9,11,16,18H,2-6,10H2,1H3/b13-9+ |
| InChIKey | QECZCYRNLGCZJI-UKTHLTGXSA-N |
| XLogP | 4.45 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.34 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|