C15H22OS — CID 106651068
cycloocten-1-yl-(2,5-dimethylthiophen-3-yl)methanol (PubChem CID 106651068) has the molecular formula C15H22OS and a molecular weight of 250.41 g/mol. Its IUPAC name is cycloocten-1-yl-(2,5-dimethylthiophen-3-yl)methanol.
| Compound Name | cycloocten-1-yl-(2,5-dimethylthiophen-3-yl)methanol |
|---|---|
| PubChem CID | 106651068 |
| Molecular Formula | C15H22OS |
| Molecular Weight | 250.41 g/mol |
| Exact Mass | 250.14 |
| IUPAC Name | cycloocten-1-yl-(2,5-dimethylthiophen-3-yl)methanol |
| SMILES | Cc1cc(C(O)C2=CCCCCCC2)c(C)s1 |
| InChI | InChI=1S/C15H22OS/c1-11-10-14(12(2)17-11)15(16)13-8-6-4-3-5-7-9-13/h8,10,15-16H,3-7,9H2,1-2H3 |
| InChIKey | DSJHJRPALWMKBX-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.41 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|