C13H11F3OS — CID 63186629
(2,5-dimethylthiophen-3-yl)-(3,4,5-trifluorophenyl)methanol (PubChem CID 63186629) has the molecular formula C13H11F3OS and a molecular weight of 272.29 g/mol. Its IUPAC name is (2,5-dimethylthiophen-3-yl)-(3,4,5-trifluorophenyl)methanol.
| Compound Name | (2,5-dimethylthiophen-3-yl)-(3,4,5-trifluorophenyl)methanol |
|---|---|
| PubChem CID | 63186629 |
| Molecular Formula | C13H11F3OS |
| Molecular Weight | 272.29 g/mol |
| Exact Mass | 272.05 |
| IUPAC Name | (2,5-dimethylthiophen-3-yl)-(3,4,5-trifluorophenyl)methanol |
| SMILES | Cc1cc(C(O)c2cc(F)c(F)c(F)c2)c(C)s1 |
| InChI | InChI=1S/C13H11F3OS/c1-6-3-9(7(2)18-6)13(17)8-4-10(14)12(16)11(15)5-8/h3-5,13,17H,1-2H3 |
| InChIKey | DYCPDYQHJITKDR-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.29 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|