C11H12O2S — CID 61087975
(2,5-dimethylthiophen-3-yl)-(furan-3-yl)methanol (PubChem CID 61087975) has the molecular formula C11H12O2S and a molecular weight of 208.28 g/mol. Its IUPAC name is (2,5-dimethylthiophen-3-yl)-(furan-3-yl)methanol.
| Compound Name | (2,5-dimethylthiophen-3-yl)-(furan-3-yl)methanol |
|---|---|
| PubChem CID | 61087975 |
| Molecular Formula | C11H12O2S |
| Molecular Weight | 208.28 g/mol |
| Exact Mass | 208.06 |
| IUPAC Name | (2,5-dimethylthiophen-3-yl)-(furan-3-yl)methanol |
| SMILES | Cc1cc(C(O)c2ccoc2)c(C)s1 |
| InChI | InChI=1S/C11H12O2S/c1-7-5-10(8(2)14-7)11(12)9-3-4-13-6-9/h3-6,11-12H,1-2H3 |
| InChIKey | XARHCFCDFXJVTA-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 33.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.28 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |