About cycloocten-1-yl-(4,5-dibromothiophen-2-yl)methanol
cycloocten-1-yl-(4,5-dibromothiophen-2-yl)methanol (PubChem CID 106651691) has the molecular formula C13H16Br2OS
and a molecular weight of 380.15 g/mol. Its IUPAC name is cycloocten-1-yl-(4,5-dibromothiophen-2-yl)methanol.
Molecular Properties
| Compound Name | cycloocten-1-yl-(4,5-dibromothiophen-2-yl)methanol |
| PubChem CID | 106651691 |
| Molecular Formula | C13H16Br2OS |
| Molecular Weight | 380.15 g/mol |
| Exact Mass | 377.93 |
| IUPAC Name | cycloocten-1-yl-(4,5-dibromothiophen-2-yl)methanol |
| SMILES | OC(C1=CCCCCCC1)c1cc(Br)c(Br)s1 |
| InChI | InChI=1S/C13H16Br2OS/c14-10-8-11(17-13(10)15)12(16)9-6-4-2-1-3-5-7-9/h6,8,12,16H,1-5,7H2 |
| InChIKey | IRTBDZGVXVFSNI-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 380.15 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze cycloocten-1-yl-(4,5-dibromothiophen-2-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cycloocten-1-yl-(4,5-dibromothiophen-2-yl)methanol?
The IUPAC name of cycloocten-1-yl-(4,5-dibromothiophen-2-yl)methanol (CID 106651691) is cycloocten-1-yl-(4,5-dibromothiophen-2-yl)methanol.
What is the SMILES notation for cycloocten-1-yl-(4,5-dibromothiophen-2-yl)methanol?
The canonical SMILES for cycloocten-1-yl-(4,5-dibromothiophen-2-yl)methanol is OC(C1=CCCCCCC1)c1cc(Br)c(Br)s1.
What is the InChIKey of cycloocten-1-yl-(4,5-dibromothiophen-2-yl)methanol?
The InChIKey is IRTBDZGVXVFSNI-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16Br2OS/c14-10-8-11(17-13(10)15)12(16)9-6-4-2-1-3-5-7-9/h6,8,12,16H,1-5,7H2.
What are the key properties of cycloocten-1-yl-(4,5-dibromothiophen-2-yl)methanol?
cycloocten-1-yl-(4,5-dibromothiophen-2-yl)methanol has a molecular weight of 380.15 g/mol, XLogP of 5.59, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cycloocten-1-yl-(4,5-dibromothiophen-2-yl)methanol is sourced from PubChem (CID 106651691), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).