C13H16Br2OS — CID 106651691
cycloocten-1-yl-(4,5-dibromothiophen-2-yl)methanol (PubChem CID 106651691) has the molecular formula C13H16Br2OS and a molecular weight of 380.15 g/mol. Its IUPAC name is cycloocten-1-yl-(4,5-dibromothiophen-2-yl)methanol.
| Compound Name | cycloocten-1-yl-(4,5-dibromothiophen-2-yl)methanol |
|---|---|
| PubChem CID | 106651691 |
| Molecular Formula | C13H16Br2OS |
| Molecular Weight | 380.15 g/mol |
| Exact Mass | 377.93 |
| IUPAC Name | cycloocten-1-yl-(4,5-dibromothiophen-2-yl)methanol |
| SMILES | OC(C1=CCCCCCC1)c1cc(Br)c(Br)s1 |
| InChI | InChI=1S/C13H16Br2OS/c14-10-8-11(17-13(10)15)12(16)9-6-4-2-1-3-5-7-9/h6,8,12,16H,1-5,7H2 |
| InChIKey | IRTBDZGVXVFSNI-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.15 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|