C11H15NOS — CID 106651556
cyclohepten-1-yl(1,3-thiazol-5-yl)methanol (PubChem CID 106651556) has the molecular formula C11H15NOS and a molecular weight of 209.31 g/mol. Its IUPAC name is cyclohepten-1-yl(1,3-thiazol-5-yl)methanol.
| Compound Name | cyclohepten-1-yl(1,3-thiazol-5-yl)methanol |
|---|---|
| PubChem CID | 106651556 |
| Molecular Formula | C11H15NOS |
| Molecular Weight | 209.31 g/mol |
| Exact Mass | 209.09 |
| IUPAC Name | cyclohepten-1-yl(1,3-thiazol-5-yl)methanol |
| SMILES | OC(C1=CCCCCC1)c1cncs1 |
| InChI | InChI=1S/C11H15NOS/c13-11(10-7-12-8-14-10)9-5-3-1-2-4-6-9/h5,7-8,11,13H,1-4,6H2 |
| InChIKey | YJJXMKGBBFXLGV-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.31 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|