C14H16F2O — CID 82815650
cyclohexen-1-yl-(2,6-difluoro-3-methylphenyl)methanol (PubChem CID 82815650) has the molecular formula C14H16F2O and a molecular weight of 238.28 g/mol. Its IUPAC name is cyclohexen-1-yl-(2,6-difluoro-3-methylphenyl)methanol.
| Compound Name | cyclohexen-1-yl-(2,6-difluoro-3-methylphenyl)methanol |
|---|---|
| PubChem CID | 82815650 |
| Molecular Formula | C14H16F2O |
| Molecular Weight | 238.28 g/mol |
| Exact Mass | 238.12 |
| IUPAC Name | cyclohexen-1-yl-(2,6-difluoro-3-methylphenyl)methanol |
| SMILES | Cc1ccc(F)c(C(O)C2=CCCCC2)c1F |
| InChI | InChI=1S/C14H16F2O/c1-9-7-8-11(15)12(13(9)16)14(17)10-5-3-2-4-6-10/h5,7-8,14,17H,2-4,6H2,1H3 |
| InChIKey | KHPHPPZFHGFCQC-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.28 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|