C13H13ClF2O — CID 82773069
(4-chloro-2,5-difluorophenyl)-(cyclohexen-1-yl)methanol (PubChem CID 82773069) has the molecular formula C13H13ClF2O and a molecular weight of 258.69 g/mol. Its IUPAC name is (4-chloro-2,5-difluorophenyl)-(cyclohexen-1-yl)methanol.
| Compound Name | (4-chloro-2,5-difluorophenyl)-(cyclohexen-1-yl)methanol |
|---|---|
| PubChem CID | 82773069 |
| Molecular Formula | C13H13ClF2O |
| Molecular Weight | 258.69 g/mol |
| Exact Mass | 258.06 |
| IUPAC Name | (4-chloro-2,5-difluorophenyl)-(cyclohexen-1-yl)methanol |
| SMILES | OC(C1=CCCCC1)c1cc(F)c(Cl)cc1F |
| InChI | InChI=1S/C13H13ClF2O/c14-10-7-11(15)9(6-12(10)16)13(17)8-4-2-1-3-5-8/h4,6-7,13,17H,1-3,5H2 |
| InChIKey | HBVYJNTVTADUQS-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.69 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|