C10H13N3O — CID 102654057
[2,3-dihydrofuran-5-yl(pyridin-4-yl)methyl]hydrazine (PubChem CID 102654057) has the molecular formula C10H13N3O and a molecular weight of 191.23 g/mol. Its IUPAC name is [2,3-dihydrofuran-5-yl(pyridin-4-yl)methyl]hydrazine.
| Compound Name | [2,3-dihydrofuran-5-yl(pyridin-4-yl)methyl]hydrazine |
|---|---|
| PubChem CID | 102654057 |
| Molecular Formula | C10H13N3O |
| Molecular Weight | 191.23 g/mol |
| Exact Mass | 191.11 |
| IUPAC Name | [2,3-dihydrofuran-5-yl(pyridin-4-yl)methyl]hydrazine |
| SMILES | NNC(C1=CCCO1)c1ccncc1 |
| InChI | InChI=1S/C10H13N3O/c11-13-10(9-2-1-7-14-9)8-3-5-12-6-4-8/h2-6,10,13H,1,7,11H2 |
| InChIKey | GBMALQMXGUMUHH-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.23 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|