C8H11N5S — CID 103140481
[(1-methylpyrazol-3-yl)-(1,3-thiazol-4-yl)methyl]hydrazine (PubChem CID 103140481) has the molecular formula C8H11N5S and a molecular weight of 209.28 g/mol. Its IUPAC name is [(1-methylpyrazol-3-yl)-(1,3-thiazol-4-yl)methyl]hydrazine.
| Compound Name | [(1-methylpyrazol-3-yl)-(1,3-thiazol-4-yl)methyl]hydrazine |
|---|---|
| PubChem CID | 103140481 |
| Molecular Formula | C8H11N5S |
| Molecular Weight | 209.28 g/mol |
| Exact Mass | 209.07 |
| IUPAC Name | [(1-methylpyrazol-3-yl)-(1,3-thiazol-4-yl)methyl]hydrazine |
| SMILES | Cn1ccc(C(NN)c2cscn2)n1 |
| InChI | InChI=1S/C8H11N5S/c1-13-3-2-6(12-13)8(11-9)7-4-14-5-10-7/h2-5,8,11H,9H2,1H3 |
| InChIKey | OMRGOROMOBSEAM-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.28 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|