C10H9F2N3S — CID 105254328
[(2,6-difluorophenyl)-(1,3-thiazol-4-yl)methyl]hydrazine (PubChem CID 105254328) has the molecular formula C10H9F2N3S and a molecular weight of 241.27 g/mol. Its IUPAC name is [(2,6-difluorophenyl)-(1,3-thiazol-4-yl)methyl]hydrazine.
| Compound Name | [(2,6-difluorophenyl)-(1,3-thiazol-4-yl)methyl]hydrazine |
|---|---|
| PubChem CID | 105254328 |
| Molecular Formula | C10H9F2N3S |
| Molecular Weight | 241.27 g/mol |
| Exact Mass | 241.05 |
| IUPAC Name | [(2,6-difluorophenyl)-(1,3-thiazol-4-yl)methyl]hydrazine |
| SMILES | NNC(c1cscn1)c1c(F)cccc1F |
| InChI | InChI=1S/C10H9F2N3S/c11-6-2-1-3-7(12)9(6)10(15-13)8-4-16-5-14-8/h1-5,10,15H,13H2 |
| InChIKey | GCQILFPZVHOGAO-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.27 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|