C11H12FN3S — CID 105254568
[(3-fluoro-5-methylphenyl)-(1,3-thiazol-4-yl)methyl]hydrazine (PubChem CID 105254568) has the molecular formula C11H12FN3S and a molecular weight of 237.30 g/mol. Its IUPAC name is [(3-fluoro-5-methylphenyl)-(1,3-thiazol-4-yl)methyl]hydrazine.
| Compound Name | [(3-fluoro-5-methylphenyl)-(1,3-thiazol-4-yl)methyl]hydrazine |
|---|---|
| PubChem CID | 105254568 |
| Molecular Formula | C11H12FN3S |
| Molecular Weight | 237.30 g/mol |
| Exact Mass | 237.07 |
| IUPAC Name | [(3-fluoro-5-methylphenyl)-(1,3-thiazol-4-yl)methyl]hydrazine |
| SMILES | Cc1cc(F)cc(C(NN)c2cscn2)c1 |
| InChI | InChI=1S/C11H12FN3S/c1-7-2-8(4-9(12)3-7)11(15-13)10-5-16-6-14-10/h2-6,11,15H,13H2,1H3 |
| InChIKey | VFXSYCLUPUFDRI-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.30 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|