C8H8ClN3S2 — CID 130698812
[(2-chlorothiophen-3-yl)-(1,3-thiazol-4-yl)methyl]hydrazine (PubChem CID 130698812) has the molecular formula C8H8ClN3S2 and a molecular weight of 245.76 g/mol. Its IUPAC name is [(2-chlorothiophen-3-yl)-(1,3-thiazol-4-yl)methyl]hydrazine.
| Compound Name | [(2-chlorothiophen-3-yl)-(1,3-thiazol-4-yl)methyl]hydrazine |
|---|---|
| PubChem CID | 130698812 |
| Molecular Formula | C8H8ClN3S2 |
| Molecular Weight | 245.76 g/mol |
| Exact Mass | 244.98 |
| IUPAC Name | [(2-chlorothiophen-3-yl)-(1,3-thiazol-4-yl)methyl]hydrazine |
| SMILES | NNC(c1cscn1)c1ccsc1Cl |
| InChI | InChI=1S/C8H8ClN3S2/c9-8-5(1-2-14-8)7(12-10)6-3-13-4-11-6/h1-4,7,12H,10H2 |
| InChIKey | SQBRQASNRJNTKP-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.76 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|