C9H11N3S2 — CID 105254496
[1-(1,3-thiazol-4-yl)-2-thiophen-3-ylethyl]hydrazine (PubChem CID 105254496) has the molecular formula C9H11N3S2 and a molecular weight of 225.34 g/mol. Its IUPAC name is [1-(1,3-thiazol-4-yl)-2-thiophen-3-ylethyl]hydrazine.
| Compound Name | [1-(1,3-thiazol-4-yl)-2-thiophen-3-ylethyl]hydrazine |
|---|---|
| PubChem CID | 105254496 |
| Molecular Formula | C9H11N3S2 |
| Molecular Weight | 225.34 g/mol |
| Exact Mass | 225.04 |
| IUPAC Name | [1-(1,3-thiazol-4-yl)-2-thiophen-3-ylethyl]hydrazine |
| SMILES | NNC(Cc1ccsc1)c1cscn1 |
| InChI | InChI=1S/C9H11N3S2/c10-12-8(9-5-14-6-11-9)3-7-1-2-13-4-7/h1-2,4-6,8,12H,3,10H2 |
| InChIKey | ZNJWMCFOSNWPGS-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.34 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|