C10H13N5S — CID 105254539
3-[2-hydrazinyl-2-(1,3-thiazol-4-yl)ethyl]pyridin-2-amine (PubChem CID 105254539) has the molecular formula C10H13N5S and a molecular weight of 235.32 g/mol. Its IUPAC name is 3-[2-hydrazinyl-2-(1,3-thiazol-4-yl)ethyl]pyridin-2-amine.
| Compound Name | 3-[2-hydrazinyl-2-(1,3-thiazol-4-yl)ethyl]pyridin-2-amine |
|---|---|
| PubChem CID | 105254539 |
| Molecular Formula | C10H13N5S |
| Molecular Weight | 235.32 g/mol |
| Exact Mass | 235.09 |
| IUPAC Name | 3-[2-hydrazinyl-2-(1,3-thiazol-4-yl)ethyl]pyridin-2-amine |
| SMILES | NNC(Cc1cccnc1N)c1cscn1 |
| InChI | InChI=1S/C10H13N5S/c11-10-7(2-1-3-13-10)4-8(15-12)9-5-16-6-14-9/h1-3,5-6,8,15H,4,12H2,(H2,11,13) |
| InChIKey | CFUUOVUVHFKHSG-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 89.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.32 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|