C16H17N5 — CID 105220678
3-(2-hydrazinyl-2-isoquinolin-1-ylethyl)pyridin-2-amine (PubChem CID 105220678) has the molecular formula C16H17N5 and a molecular weight of 279.35 g/mol. Its IUPAC name is 3-(2-hydrazinyl-2-isoquinolin-1-ylethyl)pyridin-2-amine.
| Compound Name | 3-(2-hydrazinyl-2-isoquinolin-1-ylethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 105220678 |
| Molecular Formula | C16H17N5 |
| Molecular Weight | 279.35 g/mol |
| Exact Mass | 279.15 |
| IUPAC Name | 3-(2-hydrazinyl-2-isoquinolin-1-ylethyl)pyridin-2-amine |
| SMILES | NNC(Cc1cccnc1N)c1nccc2ccccc12 |
| InChI | InChI=1S/C16H17N5/c17-16-12(5-3-8-20-16)10-14(21-18)15-13-6-2-1-4-11(13)7-9-19-15/h1-9,14,21H,10,18H2,(H2,17,20) |
| InChIKey | ITLVMQPVIGOISM-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 89.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.35 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|