C9H12N4S2 — CID 105297665
[1-(4-methylthiadiazol-5-yl)-2-thiophen-3-ylethyl]hydrazine (PubChem CID 105297665) has the molecular formula C9H12N4S2 and a molecular weight of 240.36 g/mol. Its IUPAC name is [1-(4-methylthiadiazol-5-yl)-2-thiophen-3-ylethyl]hydrazine.
| Compound Name | [1-(4-methylthiadiazol-5-yl)-2-thiophen-3-ylethyl]hydrazine |
|---|---|
| PubChem CID | 105297665 |
| Molecular Formula | C9H12N4S2 |
| Molecular Weight | 240.36 g/mol |
| Exact Mass | 240.05 |
| IUPAC Name | [1-(4-methylthiadiazol-5-yl)-2-thiophen-3-ylethyl]hydrazine |
| SMILES | Cc1nnsc1C(Cc1ccsc1)NN |
| InChI | InChI=1S/C9H12N4S2/c1-6-9(15-13-12-6)8(11-10)4-7-2-3-14-5-7/h2-3,5,8,11H,4,10H2,1H3 |
| InChIKey | NJCHKIQWXWPCMM-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.36 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|