C9H10Br2N4S — CID 103140934
[(4,5-dibromothiophen-2-yl)-(1-methylpyrazol-3-yl)methyl]hydrazine (PubChem CID 103140934) has the molecular formula C9H10Br2N4S and a molecular weight of 366.08 g/mol. Its IUPAC name is [(4,5-dibromothiophen-2-yl)-(1-methylpyrazol-3-yl)methyl]hydrazine.
| Compound Name | [(4,5-dibromothiophen-2-yl)-(1-methylpyrazol-3-yl)methyl]hydrazine |
|---|---|
| PubChem CID | 103140934 |
| Molecular Formula | C9H10Br2N4S |
| Molecular Weight | 366.08 g/mol |
| Exact Mass | 363.90 |
| IUPAC Name | [(4,5-dibromothiophen-2-yl)-(1-methylpyrazol-3-yl)methyl]hydrazine |
| SMILES | Cn1ccc(C(NN)c2cc(Br)c(Br)s2)n1 |
| InChI | InChI=1S/C9H10Br2N4S/c1-15-3-2-6(14-15)8(13-12)7-4-5(10)9(11)16-7/h2-4,8,13H,12H2,1H3 |
| InChIKey | UYWOPAKRCIARSN-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 55.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.08 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|