C9H10F3N5S — CID 106786832
[(1-methylpyrazol-3-yl)-[2-(trifluoromethyl)-1,3-thiazol-5-yl]methyl]hydrazine (PubChem CID 106786832) has the molecular formula C9H10F3N5S and a molecular weight of 277.28 g/mol. Its IUPAC name is [(1-methylpyrazol-3-yl)-[2-(trifluoromethyl)-1,3-thiazol-5-yl]methyl]hydrazine.
| Compound Name | [(1-methylpyrazol-3-yl)-[2-(trifluoromethyl)-1,3-thiazol-5-yl]methyl]hydrazine |
|---|---|
| PubChem CID | 106786832 |
| Molecular Formula | C9H10F3N5S |
| Molecular Weight | 277.28 g/mol |
| Exact Mass | 277.06 |
| IUPAC Name | [(1-methylpyrazol-3-yl)-[2-(trifluoromethyl)-1,3-thiazol-5-yl]methyl]hydrazine |
| SMILES | Cn1ccc(C(NN)c2cnc(C(F)(F)F)s2)n1 |
| InChI | InChI=1S/C9H10F3N5S/c1-17-3-2-5(16-17)7(15-13)6-4-14-8(18-6)9(10,11)12/h2-4,7,15H,13H2,1H3 |
| InChIKey | LYZQLZGFZUBAMZ-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.28 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|