C9H7ClF3N3OS — CID 106787327
[(5-chlorofuran-2-yl)-[2-(trifluoromethyl)-1,3-thiazol-5-yl]methyl]hydrazine (PubChem CID 106787327) has the molecular formula C9H7ClF3N3OS and a molecular weight of 297.69 g/mol. Its IUPAC name is [(5-chlorofuran-2-yl)-[2-(trifluoromethyl)-1,3-thiazol-5-yl]methyl]hydrazine.
| Compound Name | [(5-chlorofuran-2-yl)-[2-(trifluoromethyl)-1,3-thiazol-5-yl]methyl]hydrazine |
|---|---|
| PubChem CID | 106787327 |
| Molecular Formula | C9H7ClF3N3OS |
| Molecular Weight | 297.69 g/mol |
| Exact Mass | 297.00 |
| IUPAC Name | [(5-chlorofuran-2-yl)-[2-(trifluoromethyl)-1,3-thiazol-5-yl]methyl]hydrazine |
| SMILES | NNC(c1ccc(Cl)o1)c1cnc(C(F)(F)F)s1 |
| InChI | InChI=1S/C9H7ClF3N3OS/c10-6-2-1-4(17-6)7(16-14)5-3-15-8(18-5)9(11,12)13/h1-3,7,16H,14H2 |
| InChIKey | BEVLZZUAVAMCIQ-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 64.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.69 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|