C9H8Br2N2S2 — CID 105287631
[(4,5-dibromothiophen-2-yl)-thiophen-2-ylmethyl]hydrazine (PubChem CID 105287631) has the molecular formula C9H8Br2N2S2 and a molecular weight of 368.12 g/mol. Its IUPAC name is [(4,5-dibromothiophen-2-yl)-thiophen-2-ylmethyl]hydrazine.
| Compound Name | [(4,5-dibromothiophen-2-yl)-thiophen-2-ylmethyl]hydrazine |
|---|---|
| PubChem CID | 105287631 |
| Molecular Formula | C9H8Br2N2S2 |
| Molecular Weight | 368.12 g/mol |
| Exact Mass | 365.85 |
| IUPAC Name | [(4,5-dibromothiophen-2-yl)-thiophen-2-ylmethyl]hydrazine |
| SMILES | NNC(c1cccs1)c1cc(Br)c(Br)s1 |
| InChI | InChI=1S/C9H8Br2N2S2/c10-5-4-7(15-9(5)11)8(13-12)6-2-1-3-14-6/h1-4,8,13H,12H2 |
| InChIKey | GWBIDLNYBRTEIO-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.12 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|