C11H14ClN3O — CID 103445843
[(3-chloro-2-pyridinyl)-(3,4-dihydro-2H-pyran-6-yl)methyl]hydrazine (PubChem CID 103445843) has the molecular formula C11H14ClN3O and a molecular weight of 239.71 g/mol. Its IUPAC name is [(3-chloro-2-pyridinyl)-(3,4-dihydro-2H-pyran-6-yl)methyl]hydrazine.
| Compound Name | [(3-chloro-2-pyridinyl)-(3,4-dihydro-2H-pyran-6-yl)methyl]hydrazine |
|---|---|
| PubChem CID | 103445843 |
| Molecular Formula | C11H14ClN3O |
| Molecular Weight | 239.71 g/mol |
| Exact Mass | 239.08 |
| IUPAC Name | [(3-chloro-2-pyridinyl)-(3,4-dihydro-2H-pyran-6-yl)methyl]hydrazine |
| SMILES | NNC(C1=CCCCO1)c1ncccc1Cl |
| InChI | InChI=1S/C11H14ClN3O/c12-8-4-3-6-14-10(8)11(15-13)9-5-1-2-7-16-9/h3-6,11,15H,1-2,7,13H2 |
| InChIKey | GXLMGJLRFIDQFD-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.71 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|