C12H14ClNO — CID 102647320
(2-chlorophenyl)-(3,4-dihydro-2H-pyran-6-yl)methanamine (PubChem CID 102647320) has the molecular formula C12H14ClNO and a molecular weight of 223.70 g/mol. Its IUPAC name is (2-chlorophenyl)-(3,4-dihydro-2H-pyran-6-yl)methanamine.
| Compound Name | (2-chlorophenyl)-(3,4-dihydro-2H-pyran-6-yl)methanamine |
|---|---|
| PubChem CID | 102647320 |
| Molecular Formula | C12H14ClNO |
| Molecular Weight | 223.70 g/mol |
| Exact Mass | 223.08 |
| IUPAC Name | (2-chlorophenyl)-(3,4-dihydro-2H-pyran-6-yl)methanamine |
| SMILES | NC(C1=CCCCO1)c1ccccc1Cl |
| InChI | InChI=1S/C12H14ClNO/c13-10-6-2-1-5-9(10)12(14)11-7-3-4-8-15-11/h1-2,5-7,12H,3-4,8,14H2 |
| InChIKey | YACHKKKQDOAZKQ-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.70 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |