C11H11Cl2NO — CID 102653572
(2,6-dichlorophenyl)-(2,3-dihydrofuran-5-yl)methanamine (PubChem CID 102653572) has the molecular formula C11H11Cl2NO and a molecular weight of 244.12 g/mol. Its IUPAC name is (2,6-dichlorophenyl)-(2,3-dihydrofuran-5-yl)methanamine.
| Compound Name | (2,6-dichlorophenyl)-(2,3-dihydrofuran-5-yl)methanamine |
|---|---|
| PubChem CID | 102653572 |
| Molecular Formula | C11H11Cl2NO |
| Molecular Weight | 244.12 g/mol |
| Exact Mass | 243.02 |
| IUPAC Name | (2,6-dichlorophenyl)-(2,3-dihydrofuran-5-yl)methanamine |
| SMILES | NC(C1=CCCO1)c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C11H11Cl2NO/c12-7-3-1-4-8(13)10(7)11(14)9-5-2-6-15-9/h1,3-5,11H,2,6,14H2 |
| InChIKey | PEIVXZMQPNOPIS-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.12 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |