C9H11NOS — CID 102651186
2,3-dihydrofuran-5-yl(thiophen-2-yl)methanamine (PubChem CID 102651186) has the molecular formula C9H11NOS and a molecular weight of 181.26 g/mol. Its IUPAC name is 2,3-dihydrofuran-5-yl(thiophen-2-yl)methanamine.
| Compound Name | 2,3-dihydrofuran-5-yl(thiophen-2-yl)methanamine |
|---|---|
| PubChem CID | 102651186 |
| Molecular Formula | C9H11NOS |
| Molecular Weight | 181.26 g/mol |
| Exact Mass | 181.06 |
| IUPAC Name | 2,3-dihydrofuran-5-yl(thiophen-2-yl)methanamine |
| SMILES | NC(C1=CCCO1)c1cccs1 |
| InChI | InChI=1S/C9H11NOS/c10-9(7-3-1-5-11-7)8-4-2-6-12-8/h2-4,6,9H,1,5,10H2 |
| InChIKey | TUQNWAQYESZNHX-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.26 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |