C10H12N2S2 — CID 156789144
(1R,2R)-1,2-dithiophen-2-ylethane-1,2-diamine (PubChem CID 156789144) has the molecular formula C10H12N2S2 and a molecular weight of 224.35 g/mol. Its IUPAC name is (1R,2R)-1,2-dithiophen-2-ylethane-1,2-diamine.
| Compound Name | (1R,2R)-1,2-dithiophen-2-ylethane-1,2-diamine |
|---|---|
| PubChem CID | 156789144 |
| Molecular Formula | C10H12N2S2 |
| Molecular Weight | 224.35 g/mol |
| Exact Mass | 224.04 |
| IUPAC Name | (1R,2R)-1,2-dithiophen-2-ylethane-1,2-diamine |
| SMILES | N[C@@H](c1cccs1)[C@@H](N)c1cccs1 |
| InChI | InChI=1S/C10H12N2S2/c11-9(7-3-1-5-13-7)10(12)8-4-2-6-14-8/h1-6,9-10H,11-12H2/t9-,10-/m0/s1 |
| InChIKey | QOYHIHWLSZYWFP-UWVGGRQHSA-N |
| XLogP | 2.51 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.35 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |