C7H12N2S — CID 116909030
N',N'-dimethyl-1-thiophen-2-ylmethanediamine (PubChem CID 116909030) has the molecular formula C7H12N2S and a molecular weight of 156.25 g/mol. Its IUPAC name is N',N'-dimethyl-1-thiophen-2-ylmethanediamine.
| Compound Name | N',N'-dimethyl-1-thiophen-2-ylmethanediamine |
|---|---|
| PubChem CID | 116909030 |
| Molecular Formula | C7H12N2S |
| Molecular Weight | 156.25 g/mol |
| Exact Mass | 156.07 |
| IUPAC Name | N',N'-dimethyl-1-thiophen-2-ylmethanediamine |
| SMILES | CN(C)C(N)c1cccs1 |
| InChI | InChI=1S/C7H12N2S/c1-9(2)7(8)6-4-3-5-10-6/h3-5,7H,8H2,1-2H3 |
| InChIKey | KHIROORLANBMLV-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.25 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|