C9H16N4S — CID 52501435
2-[(2R)-2-(dimethylamino)-2-thiophen-2-ylethyl]guanidine (PubChem CID 52501435) has the molecular formula C9H16N4S and a molecular weight of 212.32 g/mol. Its IUPAC name is 2-[(2R)-2-(dimethylamino)-2-thiophen-2-ylethyl]guanidine.
| Compound Name | 2-[(2R)-2-(dimethylamino)-2-thiophen-2-ylethyl]guanidine |
|---|---|
| PubChem CID | 52501435 |
| Molecular Formula | C9H16N4S |
| Molecular Weight | 212.32 g/mol |
| Exact Mass | 212.11 |
| IUPAC Name | 2-[(2R)-2-(dimethylamino)-2-thiophen-2-ylethyl]guanidine |
| SMILES | CN(C)[C@H](CN=C(N)N)c1cccs1 |
| InChI | InChI=1S/C9H16N4S/c1-13(2)7(6-12-9(10)11)8-4-3-5-14-8/h3-5,7H,6H2,1-2H3,(H4,10,11,12)/t7-/m1/s1 |
| InChIKey | IZVSNQDLWDYBBF-SSDOTTSWSA-N |
| XLogP | 0.62 |
| TPSA | 67.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.32 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|