C12H13Cl2NO — CID 102648980
(2,5-dichlorophenyl)-(3,4-dihydro-2H-pyran-6-yl)methanamine (PubChem CID 102648980) has the molecular formula C12H13Cl2NO and a molecular weight of 258.15 g/mol. Its IUPAC name is (2,5-dichlorophenyl)-(3,4-dihydro-2H-pyran-6-yl)methanamine.
| Compound Name | (2,5-dichlorophenyl)-(3,4-dihydro-2H-pyran-6-yl)methanamine |
|---|---|
| PubChem CID | 102648980 |
| Molecular Formula | C12H13Cl2NO |
| Molecular Weight | 258.15 g/mol |
| Exact Mass | 257.04 |
| IUPAC Name | (2,5-dichlorophenyl)-(3,4-dihydro-2H-pyran-6-yl)methanamine |
| SMILES | NC(C1=CCCCO1)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C12H13Cl2NO/c13-8-4-5-10(14)9(7-8)12(15)11-3-1-2-6-16-11/h3-5,7,12H,1-2,6,15H2 |
| InChIKey | XITCYVMRASHYQW-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.15 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |