C11H11BrClNO — CID 107947022
(3-bromo-5-chlorophenyl)-(2,3-dihydrofuran-5-yl)methanamine (PubChem CID 107947022) has the molecular formula C11H11BrClNO and a molecular weight of 288.57 g/mol. Its IUPAC name is (3-bromo-5-chlorophenyl)-(2,3-dihydrofuran-5-yl)methanamine.
| Compound Name | (3-bromo-5-chlorophenyl)-(2,3-dihydrofuran-5-yl)methanamine |
|---|---|
| PubChem CID | 107947022 |
| Molecular Formula | C11H11BrClNO |
| Molecular Weight | 288.57 g/mol |
| Exact Mass | 286.97 |
| IUPAC Name | (3-bromo-5-chlorophenyl)-(2,3-dihydrofuran-5-yl)methanamine |
| SMILES | NC(C1=CCCO1)c1cc(Cl)cc(Br)c1 |
| InChI | InChI=1S/C11H11BrClNO/c12-8-4-7(5-9(13)6-8)11(14)10-2-1-3-15-10/h2,4-6,11H,1,3,14H2 |
| InChIKey | HYECVPRQJOKPQI-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.57 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |