C14H16N2OS — CID 102650251
[1-benzothiophen-3-yl(3,4-dihydro-2H-pyran-6-yl)methyl]hydrazine (PubChem CID 102650251) has the molecular formula C14H16N2OS and a molecular weight of 260.36 g/mol. Its IUPAC name is [1-benzothiophen-3-yl(3,4-dihydro-2H-pyran-6-yl)methyl]hydrazine.
| Compound Name | [1-benzothiophen-3-yl(3,4-dihydro-2H-pyran-6-yl)methyl]hydrazine |
|---|---|
| PubChem CID | 102650251 |
| Molecular Formula | C14H16N2OS |
| Molecular Weight | 260.36 g/mol |
| Exact Mass | 260.10 |
| IUPAC Name | [1-benzothiophen-3-yl(3,4-dihydro-2H-pyran-6-yl)methyl]hydrazine |
| SMILES | NNC(C1=CCCCO1)c1csc2ccccc12 |
| InChI | InChI=1S/C14H16N2OS/c15-16-14(12-6-3-4-8-17-12)11-9-18-13-7-2-1-5-10(11)13/h1-2,5-7,9,14,16H,3-4,8,15H2 |
| InChIKey | HLUNKBULAOORIE-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.36 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|