C10H13BrN2OS — CID 102654369
[(5-bromo-4-methylthiophen-2-yl)-(2,3-dihydrofuran-5-yl)methyl]hydrazine (PubChem CID 102654369) has the molecular formula C10H13BrN2OS and a molecular weight of 289.20 g/mol. Its IUPAC name is [(5-bromo-4-methylthiophen-2-yl)-(2,3-dihydrofuran-5-yl)methyl]hydrazine.
| Compound Name | [(5-bromo-4-methylthiophen-2-yl)-(2,3-dihydrofuran-5-yl)methyl]hydrazine |
|---|---|
| PubChem CID | 102654369 |
| Molecular Formula | C10H13BrN2OS |
| Molecular Weight | 289.20 g/mol |
| Exact Mass | 287.99 |
| IUPAC Name | [(5-bromo-4-methylthiophen-2-yl)-(2,3-dihydrofuran-5-yl)methyl]hydrazine |
| SMILES | Cc1cc(C(NN)C2=CCCO2)sc1Br |
| InChI | InChI=1S/C10H13BrN2OS/c1-6-5-8(15-10(6)11)9(13-12)7-3-2-4-14-7/h3,5,9,13H,2,4,12H2,1H3 |
| InChIKey | MYPGVXBRFVFCFA-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.20 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|