C11H21F — CID 144598222
ethane;3-fluoro-1-methylcyclohexa-1,3-diene (PubChem CID 144598222) has the molecular formula C11H21F and a molecular weight of 172.29 g/mol. Its IUPAC name is ethane;3-fluoro-1-methylcyclohexa-1,3-diene.
| Compound Name | ethane;3-fluoro-1-methylcyclohexa-1,3-diene |
|---|---|
| PubChem CID | 144598222 |
| Molecular Formula | C11H21F |
| Molecular Weight | 172.29 g/mol |
| Exact Mass | 172.16 |
| IUPAC Name | ethane;3-fluoro-1-methylcyclohexa-1,3-diene |
| SMILES | CC.CC.CC1=CC(F)=CCC1 |
| InChI | InChI=1S/C7H9F.2C2H6/c1-6-3-2-4-7(8)5-6;2*1-2/h4-5H,2-3H2,1H3;2*1-2H3 |
| InChIKey | IGRPBRUBAZCZKW-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.29 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |