C11H21NOS — CID 170725421
ethane;N,N,5-trimethylcyclohexa-1,5-diene-1-sulfinamide (PubChem CID 170725421) has the molecular formula C11H21NOS and a molecular weight of 215.36 g/mol. Its IUPAC name is ethane;N,N,5-trimethylcyclohexa-1,5-diene-1-sulfinamide.
| Compound Name | ethane;N,N,5-trimethylcyclohexa-1,5-diene-1-sulfinamide |
|---|---|
| PubChem CID | 170725421 |
| Molecular Formula | C11H21NOS |
| Molecular Weight | 215.36 g/mol |
| Exact Mass | 215.13 |
| IUPAC Name | ethane;N,N,5-trimethylcyclohexa-1,5-diene-1-sulfinamide |
| SMILES | CC.CC1=CC(S(=O)N(C)C)=CCC1 |
| InChI | InChI=1S/C9H15NOS.C2H6/c1-8-5-4-6-9(7-8)12(11)10(2)3;1-2/h6-7H,4-5H2,1-3H3;1-2H3 |
| InChIKey | IDJRKMLQEODKMJ-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.36 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |