C11H22O3 — CID 155705455
ethane;3-methylcyclopent-2-en-1-one;propane-2,2-diol (PubChem CID 155705455) has the molecular formula C11H22O3 and a molecular weight of 202.29 g/mol. Its IUPAC name is ethane;3-methylcyclopent-2-en-1-one;propane-2,2-diol.
| Compound Name | ethane;3-methylcyclopent-2-en-1-one;propane-2,2-diol |
|---|---|
| PubChem CID | 155705455 |
| Molecular Formula | C11H22O3 |
| Molecular Weight | 202.29 g/mol |
| Exact Mass | 202.16 |
| IUPAC Name | ethane;3-methylcyclopent-2-en-1-one;propane-2,2-diol |
| SMILES | CC.CC(C)(O)O.CC1=CC(=O)CC1 |
| InChI | InChI=1S/C6H8O.C3H8O2.C2H6/c1-5-2-3-6(7)4-5;1-3(2,4)5;1-2/h4H,2-3H2,1H3;4-5H,1-2H3;1-2H3 |
| InChIKey | UQEZYNSICDFKIX-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.29 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|