C17H22O — CID 142554767
ethane;1-[4-(5-methylcyclohexa-1,5-dien-1-yl)phenyl]ethenol (PubChem CID 142554767) has the molecular formula C17H22O and a molecular weight of 242.36 g/mol. Its IUPAC name is ethane;1-[4-(5-methylcyclohexa-1,5-dien-1-yl)phenyl]ethenol.
| Compound Name | ethane;1-[4-(5-methylcyclohexa-1,5-dien-1-yl)phenyl]ethenol |
|---|---|
| PubChem CID | 142554767 |
| Molecular Formula | C17H22O |
| Molecular Weight | 242.36 g/mol |
| Exact Mass | 242.17 |
| IUPAC Name | ethane;1-[4-(5-methylcyclohexa-1,5-dien-1-yl)phenyl]ethenol |
| SMILES | C=C(O)c1ccc(C2=CCCC(C)=C2)cc1.CC |
| InChI | InChI=1S/C15H16O.C2H6/c1-11-4-3-5-15(10-11)14-8-6-13(7-9-14)12(2)16;1-2/h5-10,16H,2-4H2,1H3;1-2H3 |
| InChIKey | VVZSQFRBQCAIEQ-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.36 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|